C19H29NO2S — CID 97225607
(2S)-1-(4-methylsulfonylbutyl)-2-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine (PubChem CID 97225607) has the molecular formula C19H29NO2S and a molecular weight of 335.51 g/mol. Its IUPAC name is (2S)-1-(4-methylsulfonylbutyl)-2-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine.
| Compound Name | (2S)-1-(4-methylsulfonylbutyl)-2-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine |
|---|---|
| PubChem CID | 97225607 |
| Molecular Formula | C19H29NO2S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (2S)-1-(4-methylsulfonylbutyl)-2-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine |
| SMILES | CS(=O)(=O)CCCCN1CCC[C@H]1[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C19H29NO2S/c1-23(21,22)15-5-4-13-20-14-7-12-19(20)18-11-6-9-16-8-2-3-10-17(16)18/h2-3,8,10,18-19H,4-7,9,11-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | GMYMFWXGMSIVJE-MOPGFXCFSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|