C13H17FN2O3S — CID 97226413
5-fluoro-N,3-dimethyl-N-[(2S)-1-methylsulfanylpropan-2-yl]-2-nitrobenzamide (PubChem CID 97226413) has the molecular formula C13H17FN2O3S and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-fluoro-N,3-dimethyl-N-[(2S)-1-methylsulfanylpropan-2-yl]-2-nitrobenzamide.
| Compound Name | 5-fluoro-N,3-dimethyl-N-[(2S)-1-methylsulfanylpropan-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 97226413 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-fluoro-N,3-dimethyl-N-[(2S)-1-methylsulfanylpropan-2-yl]-2-nitrobenzamide |
| SMILES | CSC[C@H](C)N(C)C(=O)c1cc(F)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17FN2O3S/c1-8-5-10(14)6-11(12(8)16(18)19)13(17)15(3)9(2)7-20-4/h5-6,9H,7H2,1-4H3/t9-/m0/s1 |
| InChIKey | ALJBIPMXDGLUOD-VIFPVBQESA-N |
| XLogP | 2.87 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|