C17H24N2O3S — CID 97226464
N-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[(2S)-oxolan-2-yl]ethanesulfonamide (PubChem CID 97226464) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[(2S)-oxolan-2-yl]ethanesulfonamide.
| Compound Name | N-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[(2S)-oxolan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 97226464 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[(2S)-oxolan-2-yl]ethanesulfonamide |
| SMILES | Cc1ccc2c(CCNS(=O)(=O)CC[C@@H]3CCCO3)c[nH]c2c1 |
| InChI | InChI=1S/C17H24N2O3S/c1-13-4-5-16-14(12-18-17(16)11-13)6-8-19-23(20,21)10-7-15-3-2-9-22-15/h4-5,11-12,15,18-19H,2-3,6-10H2,1H3/t15-/m0/s1 |
| InChIKey | MILUOJMPSQWBKH-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |