C15H17F2NO2S — CID 97229548
(1S)-2-[[(1S)-1-[4-(difluoromethylsulfanyl)phenyl]ethyl]amino]-1-(furan-2-yl)ethanol (PubChem CID 97229548) has the molecular formula C15H17F2NO2S and a molecular weight of 313.37 g/mol. Its IUPAC name is (1S)-2-[[(1S)-1-[4-(difluoromethylsulfanyl)phenyl]ethyl]amino]-1-(furan-2-yl)ethanol.
| Compound Name | (1S)-2-[[(1S)-1-[4-(difluoromethylsulfanyl)phenyl]ethyl]amino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 97229548 |
| Molecular Formula | C15H17F2NO2S |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (1S)-2-[[(1S)-1-[4-(difluoromethylsulfanyl)phenyl]ethyl]amino]-1-(furan-2-yl)ethanol |
| SMILES | C[C@H](NC[C@H](O)c1ccco1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H17F2NO2S/c1-10(18-9-13(19)14-3-2-8-20-14)11-4-6-12(7-5-11)21-15(16)17/h2-8,10,13,15,18-19H,9H2,1H3/t10-,13-/m0/s1 |
| InChIKey | NJFKIUJRPMXIFZ-GWCFXTLKSA-N |
| XLogP | 3.98 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |