C19H29N5 — CID 97229601
(1R)-3-methyl-1-pyridin-2-yl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butan-1-amine (PubChem CID 97229601) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is (1R)-3-methyl-1-pyridin-2-yl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butan-1-amine.
| Compound Name | (1R)-3-methyl-1-pyridin-2-yl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 97229601 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | (1R)-3-methyl-1-pyridin-2-yl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]butan-1-amine |
| SMILES | CC(C)C[C@@H](NCCc1nnc2n1CCCCC2)c1ccccn1 |
| InChI | InChI=1S/C19H29N5/c1-15(2)14-17(16-8-5-6-11-20-16)21-12-10-19-23-22-18-9-4-3-7-13-24(18)19/h5-6,8,11,15,17,21H,3-4,7,9-10,12-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | UPSCSZLFHWALLC-QGZVFWFLSA-N |
| XLogP | 3.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |