C17H26N4S — CID 97229603
(1S)-1-(2,5-dimethylthiophen-3-yl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine (PubChem CID 97229603) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is (1S)-1-(2,5-dimethylthiophen-3-yl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine.
| Compound Name | (1S)-1-(2,5-dimethylthiophen-3-yl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 97229603 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (1S)-1-(2,5-dimethylthiophen-3-yl)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]ethanamine |
| SMILES | Cc1cc([C@H](C)NCCc2nnc3n2CCCCC3)c(C)s1 |
| InChI | InChI=1S/C17H26N4S/c1-12-11-15(14(3)22-12)13(2)18-9-8-17-20-19-16-7-5-4-6-10-21(16)17/h11,13,18H,4-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | WLQSHTAPSAQFNB-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |