C16H30N4S — CID 97229609
(2R)-1-tert-butylsulfanyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]propan-2-amine (PubChem CID 97229609) has the molecular formula C16H30N4S and a molecular weight of 310.51 g/mol. Its IUPAC name is (2R)-1-tert-butylsulfanyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]propan-2-amine.
| Compound Name | (2R)-1-tert-butylsulfanyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 97229609 |
| Molecular Formula | C16H30N4S |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (2R)-1-tert-butylsulfanyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]propan-2-amine |
| SMILES | C[C@H](CSC(C)(C)C)NCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C16H30N4S/c1-13(12-21-16(2,3)4)17-10-9-15-19-18-14-8-6-5-7-11-20(14)15/h13,17H,5-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | FHPHUXSNKQHLSJ-CYBMUJFWSA-N |
| XLogP | 3.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |