C16H21NO3S2 — CID 97230685
(1S)-1-(3-methoxy-4-methylsulfonylphenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine (PubChem CID 97230685) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (1S)-1-(3-methoxy-4-methylsulfonylphenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(3-methoxy-4-methylsulfonylphenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 97230685 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (1S)-1-(3-methoxy-4-methylsulfonylphenyl)-N-[(3-methylthiophen-2-yl)methyl]ethanamine |
| SMILES | COc1cc([C@H](C)NCc2sccc2C)ccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H21NO3S2/c1-11-7-8-21-15(11)10-17-12(2)13-5-6-16(22(4,18)19)14(9-13)20-3/h5-9,12,17H,10H2,1-4H3/t12-/m0/s1 |
| InChIKey | OUKIZAMHQFIEAJ-LBPRGKRZSA-N |
| XLogP | 3.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |