C16H19F2NO3 — CID 97232870
(2S)-1-[[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]amino]-2-(furan-2-yl)propan-2-ol (PubChem CID 97232870) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is (2S)-1-[[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]amino]-2-(furan-2-yl)propan-2-ol.
| Compound Name | (2S)-1-[[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]amino]-2-(furan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 97232870 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2S)-1-[[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]amino]-2-(furan-2-yl)propan-2-ol |
| SMILES | C[C@@H](NC[C@](C)(O)c1ccco1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H19F2NO3/c1-11(12-5-3-6-13(9-12)22-15(17)18)19-10-16(2,20)14-7-4-8-21-14/h3-9,11,15,19-20H,10H2,1-2H3/t11-,16+/m1/s1 |
| InChIKey | YUSBSWRTCZQGOW-BZNIZROVSA-N |
| XLogP | 3.44 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |