C19H19F2NO5 — CID 97233833
(2S)-2-(2,5-difluorophenyl)-2-[[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid (PubChem CID 97233833) has the molecular formula C19H19F2NO5 and a molecular weight of 379.36 g/mol. Its IUPAC name is (2S)-2-(2,5-difluorophenyl)-2-[[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-(2,5-difluorophenyl)-2-[[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 97233833 |
| Molecular Formula | C19H19F2NO5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2S)-2-(2,5-difluorophenyl)-2-[[3-(2-methoxyethoxy)benzoyl]amino]propanoic acid |
| SMILES | COCCOc1cccc(C(=O)N[C@](C)(C(=O)O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C19H19F2NO5/c1-19(18(24)25,15-11-13(20)6-7-16(15)21)22-17(23)12-4-3-5-14(10-12)27-9-8-26-2/h3-7,10-11H,8-9H2,1-2H3,(H,22,23)(H,24,25)/t19-/m0/s1 |
| InChIKey | VOUUTQVJDSEQHW-IBGZPJMESA-N |
| XLogP | 2.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|