C18H18FNO3 — CID 97234530
3-[4-[[(2R)-2-(2-fluorophenyl)propanoyl]amino]phenyl]propanoic acid (PubChem CID 97234530) has the molecular formula C18H18FNO3 and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-[4-[[(2R)-2-(2-fluorophenyl)propanoyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[(2R)-2-(2-fluorophenyl)propanoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 97234530 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-[4-[[(2R)-2-(2-fluorophenyl)propanoyl]amino]phenyl]propanoic acid |
| SMILES | C[C@@H](C(=O)Nc1ccc(CCC(=O)O)cc1)c1ccccc1F |
| InChI | InChI=1S/C18H18FNO3/c1-12(15-4-2-3-5-16(15)19)18(23)20-14-9-6-13(7-10-14)8-11-17(21)22/h2-7,9-10,12H,8,11H2,1H3,(H,20,23)(H,21,22)/t12-/m1/s1 |
| InChIKey | WCUWVONBLQMHIS-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |