About 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine
6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 97234871) has the molecular formula C14H19ClO4S
and a molecular weight of 318.82 g/mol. Its IUPAC name is 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 97234871 |
| Molecular Formula | C14H19ClO4S |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | COCCCCC[S@](=O)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C14H19ClO4S/c1-17-5-3-2-4-8-20(16)14-10-13-12(9-11(14)15)18-6-7-19-13/h9-10H,2-8H2,1H3/t20-/m0/s1 |
| InChIKey | PVWJRZRWAWRKKA-FQEVSTJZSA-N |
| XLogP | 3.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine (CID 97234871) is 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine is COCCCCC[S@](=O)c1cc2c(cc1Cl)OCCO2.
What is the InChIKey of 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine?
The InChIKey is PVWJRZRWAWRKKA-FQEVSTJZSA-N. The full InChI is InChI=1S/C14H19ClO4S/c1-17-5-3-2-4-8-20(16)14-10-13-12(9-11(14)15)18-6-7-19-13/h9-10H,2-8H2,1H3/t20-/m0/s1.
What are the key properties of 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine?
6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine has a molecular weight of 318.82 g/mol, XLogP of 3.04, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-[(S)-5-methoxypentylsulfinyl]-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 97234871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).