C20H27N3O2 — CID 97235875
1H-indol-7-yl-[(3S)-3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]methanone (PubChem CID 97235875) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1H-indol-7-yl-[(3S)-3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]methanone.
| Compound Name | 1H-indol-7-yl-[(3S)-3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 97235875 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1H-indol-7-yl-[(3S)-3-(2-piperidin-1-ylethoxy)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc2cc[nH]c12)N1CC[C@H](OCCN2CCCCC2)C1 |
| InChI | InChI=1S/C20H27N3O2/c24-20(18-6-4-5-16-7-9-21-19(16)18)23-12-8-17(15-23)25-14-13-22-10-2-1-3-11-22/h4-7,9,17,21H,1-3,8,10-15H2/t17-/m0/s1 |
| InChIKey | YBXVANCMPQZKOB-KRWDZBQOSA-N |
| XLogP | 2.88 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |