C18H21N3O2S — CID 97236872
[(2S)-2-(2-methylphenyl)morpholin-4-yl]-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]methanone (PubChem CID 97236872) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is [(2S)-2-(2-methylphenyl)morpholin-4-yl]-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]methanone.
| Compound Name | [(2S)-2-(2-methylphenyl)morpholin-4-yl]-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 97236872 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(2S)-2-(2-methylphenyl)morpholin-4-yl]-[2-(prop-2-enylamino)-1,3-thiazol-5-yl]methanone |
| SMILES | C=CCNc1ncc(C(=O)N2CCO[C@@H](c3ccccc3C)C2)s1 |
| InChI | InChI=1S/C18H21N3O2S/c1-3-8-19-18-20-11-16(24-18)17(22)21-9-10-23-15(12-21)14-7-5-4-6-13(14)2/h3-7,11,15H,1,8-10,12H2,2H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | ITTKDMLOGZNQCS-OAHLLOKOSA-N |
| XLogP | 3.26 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|