C14H19N3O2 — CID 97238740
5-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carbonyl]-1-methylpyrrole-3-carbonitrile (PubChem CID 97238740) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carbonyl]-1-methylpyrrole-3-carbonitrile.
| Compound Name | 5-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carbonyl]-1-methylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 97238740 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-[(2S)-2-(2-hydroxypropan-2-yl)pyrrolidine-1-carbonyl]-1-methylpyrrole-3-carbonitrile |
| SMILES | Cn1cc(C#N)cc1C(=O)N1CCC[C@H]1C(C)(C)O |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,19)12-5-4-6-17(12)13(18)11-7-10(8-15)9-16(11)3/h7,9,12,19H,4-6H2,1-3H3/t12-/m0/s1 |
| InChIKey | LGZYHUOWAWLVLT-LBPRGKRZSA-N |
| XLogP | 1.27 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |