C12H17N7O2 — CID 97239707
1-[(1R)-2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-prop-2-enylurea (PubChem CID 97239707) has the molecular formula C12H17N7O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-[(1R)-2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-prop-2-enylurea.
| Compound Name | 1-[(1R)-2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 97239707 |
| Molecular Formula | C12H17N7O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[(1R)-2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)N[C@@H](c1nc(-c2ncn[nH]2)no1)C(C)C |
| InChI | InChI=1S/C12H17N7O2/c1-4-5-13-12(20)16-8(7(2)3)11-17-10(19-21-11)9-14-6-15-18-9/h4,6-8H,1,5H2,2-3H3,(H2,13,16,20)(H,14,15,18)/t8-/m1/s1 |
| InChIKey | WZOCDPNISABZTR-MRVPVSSYSA-N |
| XLogP | 1.04 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|