C18H18ClN3O2 — CID 97240661
3-chloro-2-N-[(1R,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-2,5-dicarboxamide (PubChem CID 97240661) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 3-chloro-2-N-[(1R,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-2,5-dicarboxamide.
| Compound Name | 3-chloro-2-N-[(1R,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 97240661 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-chloro-2-N-[(1R,4R)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]pyridine-2,5-dicarboxamide |
| SMILES | C[C@@H]1CC[C@@H](NC(=O)c2ncc(C(N)=O)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H18ClN3O2/c1-10-6-7-15(13-5-3-2-4-12(10)13)22-18(24)16-14(19)8-11(9-21-16)17(20)23/h2-5,8-10,15H,6-7H2,1H3,(H2,20,23)(H,22,24)/t10-,15-/m1/s1 |
| InChIKey | LAJSRAKHPGQIBZ-MEBBXXQBSA-N |
| XLogP | 3.20 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |