C13H14Cl3N3O — CID 97242539
[4-(3-chloro-4-pyridinyl)piperazin-1-yl]-[(1R)-2,2-dichlorocyclopropyl]methanone (PubChem CID 97242539) has the molecular formula C13H14Cl3N3O and a molecular weight of 334.63 g/mol. Its IUPAC name is [4-(3-chloro-4-pyridinyl)piperazin-1-yl]-[(1R)-2,2-dichlorocyclopropyl]methanone.
| Compound Name | [4-(3-chloro-4-pyridinyl)piperazin-1-yl]-[(1R)-2,2-dichlorocyclopropyl]methanone |
|---|---|
| PubChem CID | 97242539 |
| Molecular Formula | C13H14Cl3N3O |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | [4-(3-chloro-4-pyridinyl)piperazin-1-yl]-[(1R)-2,2-dichlorocyclopropyl]methanone |
| SMILES | O=C([C@H]1CC1(Cl)Cl)N1CCN(c2ccncc2Cl)CC1 |
| InChI | InChI=1S/C13H14Cl3N3O/c14-10-8-17-2-1-11(10)18-3-5-19(6-4-18)12(20)9-7-13(9,15)16/h1-2,8-9H,3-7H2/t9-/m1/s1 |
| InChIKey | ZHDZHVBYVPXKCK-SECBINFHSA-N |
| XLogP | 2.58 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|