C16H23ClN2O3 — CID 97242852
3-[2-(2-chlorophenoxy)ethyl]-1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-methylurea (PubChem CID 97242852) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethyl]-1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-methylurea.
| Compound Name | 3-[2-(2-chlorophenoxy)ethyl]-1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 97242852 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethyl]-1-[[(1R,2S)-2-hydroxycyclopentyl]methyl]-1-methylurea |
| SMILES | CN(C[C@H]1CCC[C@@H]1O)C(=O)NCCOc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O3/c1-19(11-12-5-4-7-14(12)20)16(21)18-9-10-22-15-8-3-2-6-13(15)17/h2-3,6,8,12,14,20H,4-5,7,9-11H2,1H3,(H,18,21)/t12-,14+/m1/s1 |
| InChIKey | ALVUJQGBPMWREZ-OCCSQVGLSA-N |
| XLogP | 2.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|