C16H24ClN3O2 — CID 109396977
3-[3-chloro-2-(dimethylamino)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea (PubChem CID 109396977) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-[3-chloro-2-(dimethylamino)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea.
| Compound Name | 3-[3-chloro-2-(dimethylamino)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 109396977 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 3-[3-chloro-2-(dimethylamino)phenyl]-1-[(2-hydroxycyclopentyl)methyl]-1-methylurea |
| SMILES | CN(CC1CCCC1O)C(=O)Nc1cccc(Cl)c1N(C)C |
| InChI | InChI=1S/C16H24ClN3O2/c1-19(2)15-12(17)7-5-8-13(15)18-16(22)20(3)10-11-6-4-9-14(11)21/h5,7-8,11,14,21H,4,6,9-10H2,1-3H3,(H,18,22) |
| InChIKey | HAZWOQJLPSGFPL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |