C20H22N2O3 — CID 97242926
N-[4-hydroxy-3-[(2R,3R)-3-methyl-2-phenylazetidine-1-carbonyl]phenyl]propanamide (PubChem CID 97242926) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[4-hydroxy-3-[(2R,3R)-3-methyl-2-phenylazetidine-1-carbonyl]phenyl]propanamide.
| Compound Name | N-[4-hydroxy-3-[(2R,3R)-3-methyl-2-phenylazetidine-1-carbonyl]phenyl]propanamide |
|---|---|
| PubChem CID | 97242926 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[4-hydroxy-3-[(2R,3R)-3-methyl-2-phenylazetidine-1-carbonyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(O)c(C(=O)N2C[C@@H](C)[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-3-18(24)21-15-9-10-17(23)16(11-15)20(25)22-12-13(2)19(22)14-7-5-4-6-8-14/h4-11,13,19,23H,3,12H2,1-2H3,(H,21,24)/t13-,19-/m1/s1 |
| InChIKey | DHFOQQZNAXGGQS-BFUOFWGJSA-N |
| XLogP | 3.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|