C16H25FN2O3S — CID 97243163
2-fluoro-N-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-methylbenzenesulfonamide (PubChem CID 97243163) has the molecular formula C16H25FN2O3S and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-methylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 97243163 |
| Molecular Formula | C16H25FN2O3S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-fluoro-N-[(2R)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-methylbenzenesulfonamide |
| SMILES | CC1CCN(C[C@@H](O)CN(C)S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H25FN2O3S/c1-13-7-9-19(10-8-13)12-14(20)11-18(2)23(21,22)16-6-4-3-5-15(16)17/h3-6,13-14,20H,7-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | GICXDLNLIWQVSC-AWEZNQCLSA-N |
| XLogP | 1.54 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |