C14H20ClN3O — CID 97246020
(3S,6S)-1-[(6-chloro-2-methyl-3-pyridinyl)methyl]-6-methylpiperidine-3-carboxamide (PubChem CID 97246020) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is (3S,6S)-1-[(6-chloro-2-methyl-3-pyridinyl)methyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6S)-1-[(6-chloro-2-methyl-3-pyridinyl)methyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97246020 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (3S,6S)-1-[(6-chloro-2-methyl-3-pyridinyl)methyl]-6-methylpiperidine-3-carboxamide |
| SMILES | Cc1nc(Cl)ccc1CN1C[C@@H](C(N)=O)CC[C@@H]1C |
| InChI | InChI=1S/C14H20ClN3O/c1-9-3-4-12(14(16)19)8-18(9)7-11-5-6-13(15)17-10(11)2/h5-6,9,12H,3-4,7-8H2,1-2H3,(H2,16,19)/t9-,12-/m0/s1 |
| InChIKey | CWSYPUFKIFMTST-CABZTGNLSA-N |
| XLogP | 2.13 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|