C17H34N4OS — CID 97246357
(3S)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-3-methylsulfanylazepane-1-carboxamide (PubChem CID 97246357) has the molecular formula C17H34N4OS and a molecular weight of 342.55 g/mol. Its IUPAC name is (3S)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-3-methylsulfanylazepane-1-carboxamide.
| Compound Name | (3S)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-3-methylsulfanylazepane-1-carboxamide |
|---|---|
| PubChem CID | 97246357 |
| Molecular Formula | C17H34N4OS |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | (3S)-N-[2-[4-(dimethylamino)piperidin-1-yl]ethyl]-3-methylsulfanylazepane-1-carboxamide |
| SMILES | CS[C@H]1CCCCN(C(=O)NCCN2CCC(N(C)C)CC2)C1 |
| InChI | InChI=1S/C17H34N4OS/c1-19(2)15-7-11-20(12-8-15)13-9-18-17(22)21-10-5-4-6-16(14-21)23-3/h15-16H,4-14H2,1-3H3,(H,18,22)/t16-/m0/s1 |
| InChIKey | DXGHUYNJFVOMES-INIZCTEOSA-N |
| XLogP | 1.94 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |