C18H20N4O6 — CID 97246872
ethyl 5-[[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoacetyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 97246872) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 5-[[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoacetyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoacetyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 97246872 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | ethyl 5-[[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoacetyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1NC(=O)C(=O)N[C@H](C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N4O6/c1-4-26-18(25)12-8-19-22(3)15(12)21-17(24)16(23)20-10(2)11-5-6-13-14(7-11)28-9-27-13/h5-8,10H,4,9H2,1-3H3,(H,20,23)(H,21,24)/t10-/m1/s1 |
| InChIKey | GBMZEMPRPDGZKR-SNVBAGLBSA-N |
| XLogP | 1.14 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|