C25H29N3O3 — CID 97248440
tert-butyl N-[(2R)-2-naphthalen-2-yl-2-(3-pyridin-4-ylpropanoylamino)ethyl]carbamate (PubChem CID 97248440) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-naphthalen-2-yl-2-(3-pyridin-4-ylpropanoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-naphthalen-2-yl-2-(3-pyridin-4-ylpropanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 97248440 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl N-[(2R)-2-naphthalen-2-yl-2-(3-pyridin-4-ylpropanoylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](NC(=O)CCc1ccncc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H29N3O3/c1-25(2,3)31-24(30)27-17-22(21-10-9-19-6-4-5-7-20(19)16-21)28-23(29)11-8-18-12-14-26-15-13-18/h4-7,9-10,12-16,22H,8,11,17H2,1-3H3,(H,27,30)(H,28,29)/t22-/m0/s1 |
| InChIKey | GBUNLCPSLCHYOU-QFIPXVFZSA-N |
| XLogP | 4.55 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |