C22H20N2O2 — CID 97248519
4-[(1S)-1-benzyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1H-pyridin-2-one (PubChem CID 97248519) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[(1S)-1-benzyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1H-pyridin-2-one.
| Compound Name | 4-[(1S)-1-benzyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 97248519 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[(1S)-1-benzyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cc[nH]c(=O)c1)N1CCc2ccccc2[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H20N2O2/c25-21-15-18(10-12-23-21)22(26)24-13-11-17-8-4-5-9-19(17)20(24)14-16-6-2-1-3-7-16/h1-10,12,15,20H,11,13-14H2,(H,23,25)/t20-/m0/s1 |
| InChIKey | JXHYEXSDFREUCH-FQEVSTJZSA-N |
| XLogP | 3.36 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |