C13H18ClFN2O3S — CID 97248897
1-[(4-chloro-3-fluorophenyl)methyl]-1-methyl-3-[(2R)-1-methylsulfonylpropan-2-yl]urea (PubChem CID 97248897) has the molecular formula C13H18ClFN2O3S and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-[(4-chloro-3-fluorophenyl)methyl]-1-methyl-3-[(2R)-1-methylsulfonylpropan-2-yl]urea.
| Compound Name | 1-[(4-chloro-3-fluorophenyl)methyl]-1-methyl-3-[(2R)-1-methylsulfonylpropan-2-yl]urea |
|---|---|
| PubChem CID | 97248897 |
| Molecular Formula | C13H18ClFN2O3S |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-[(4-chloro-3-fluorophenyl)methyl]-1-methyl-3-[(2R)-1-methylsulfonylpropan-2-yl]urea |
| SMILES | C[C@H](CS(C)(=O)=O)NC(=O)N(C)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H18ClFN2O3S/c1-9(8-21(3,19)20)16-13(18)17(2)7-10-4-5-11(14)12(15)6-10/h4-6,9H,7-8H2,1-3H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | FDJNDIATOHTCNA-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |