C17H26N2O4 — CID 97252291
1-[[(4R)-1,3-dioxan-4-yl]methyl]-3-[3-(3-methylbutoxy)phenyl]urea (PubChem CID 97252291) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[[(4R)-1,3-dioxan-4-yl]methyl]-3-[3-(3-methylbutoxy)phenyl]urea.
| Compound Name | 1-[[(4R)-1,3-dioxan-4-yl]methyl]-3-[3-(3-methylbutoxy)phenyl]urea |
|---|---|
| PubChem CID | 97252291 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[[(4R)-1,3-dioxan-4-yl]methyl]-3-[3-(3-methylbutoxy)phenyl]urea |
| SMILES | CC(C)CCOc1cccc(NC(=O)NC[C@H]2CCOCO2)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-13(2)6-9-22-15-5-3-4-14(10-15)19-17(20)18-11-16-7-8-21-12-23-16/h3-5,10,13,16H,6-9,11-12H2,1-2H3,(H2,18,19,20)/t16-/m1/s1 |
| InChIKey | QZALODSKDHSYLD-MRXNPFEDSA-N |
| XLogP | 3.00 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |