C16H26N4O3S — CID 97253655
1-[3-(4-methylpiperidin-1-yl)phenyl]-3-[(2R)-2-sulfamoylpropyl]urea (PubChem CID 97253655) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-[3-(4-methylpiperidin-1-yl)phenyl]-3-[(2R)-2-sulfamoylpropyl]urea.
| Compound Name | 1-[3-(4-methylpiperidin-1-yl)phenyl]-3-[(2R)-2-sulfamoylpropyl]urea |
|---|---|
| PubChem CID | 97253655 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[3-(4-methylpiperidin-1-yl)phenyl]-3-[(2R)-2-sulfamoylpropyl]urea |
| SMILES | CC1CCN(c2cccc(NC(=O)NC[C@@H](C)S(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C16H26N4O3S/c1-12-6-8-20(9-7-12)15-5-3-4-14(10-15)19-16(21)18-11-13(2)24(17,22)23/h3-5,10,12-13H,6-9,11H2,1-2H3,(H2,17,22,23)(H2,18,19,21)/t13-/m1/s1 |
| InChIKey | LXVFPCDCNSVNRP-CYBMUJFWSA-N |
| XLogP | 1.72 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |