C18H27NO — CID 97255009
(2S)-2-(2,3-dimethylphenyl)-1-(oxan-4-yl)piperidine (PubChem CID 97255009) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (2S)-2-(2,3-dimethylphenyl)-1-(oxan-4-yl)piperidine.
| Compound Name | (2S)-2-(2,3-dimethylphenyl)-1-(oxan-4-yl)piperidine |
|---|---|
| PubChem CID | 97255009 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S)-2-(2,3-dimethylphenyl)-1-(oxan-4-yl)piperidine |
| SMILES | Cc1cccc([C@@H]2CCCCN2C2CCOCC2)c1C |
| InChI | InChI=1S/C18H27NO/c1-14-6-5-7-17(15(14)2)18-8-3-4-11-19(18)16-9-12-20-13-10-16/h5-7,16,18H,3-4,8-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | VOFNPIGJHFXMGT-SFHVURJKSA-N |
| XLogP | 4.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |