C25H20N2O4 — CID 97255080
3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]-N-(9-oxoxanthen-2-yl)benzamide (PubChem CID 97255080) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]-N-(9-oxoxanthen-2-yl)benzamide.
| Compound Name | 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]-N-(9-oxoxanthen-2-yl)benzamide |
|---|---|
| PubChem CID | 97255080 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 3-[[(1R,2R)-2-methylcyclopropanecarbonyl]amino]-N-(9-oxoxanthen-2-yl)benzamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)Nc1cccc(C(=O)Nc2ccc3oc4ccccc4c(=O)c3c2)c1 |
| InChI | InChI=1S/C25H20N2O4/c1-14-11-19(14)25(30)27-16-6-4-5-15(12-16)24(29)26-17-9-10-22-20(13-17)23(28)18-7-2-3-8-21(18)31-22/h2-10,12-14,19H,11H2,1H3,(H,26,29)(H,27,30)/t14-,19-/m1/s1 |
| InChIKey | SXEBYZXOPSUIFJ-AUUYWEPGSA-N |
| XLogP | 4.79 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|