C20H23FN2O4S — CID 97255482
3-[(4-fluorophenyl)sulfamoyl]-N-[[(2S,4S)-2-methyloxan-4-yl]methyl]benzamide (PubChem CID 97255482) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfamoyl]-N-[[(2S,4S)-2-methyloxan-4-yl]methyl]benzamide.
| Compound Name | 3-[(4-fluorophenyl)sulfamoyl]-N-[[(2S,4S)-2-methyloxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 97255482 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfamoyl]-N-[[(2S,4S)-2-methyloxan-4-yl]methyl]benzamide |
| SMILES | C[C@H]1C[C@@H](CNC(=O)c2cccc(S(=O)(=O)Nc3ccc(F)cc3)c2)CCO1 |
| InChI | InChI=1S/C20H23FN2O4S/c1-14-11-15(9-10-27-14)13-22-20(24)16-3-2-4-19(12-16)28(25,26)23-18-7-5-17(21)6-8-18/h2-8,12,14-15,23H,9-11,13H2,1H3,(H,22,24)/t14-,15-/m0/s1 |
| InChIKey | MZDQYVCWXVVXEI-GJZGRUSLSA-N |
| XLogP | 3.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |