C18H22N2O3 — CID 97256616
methyl (2S,3S)-3-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pent-4-enoate (PubChem CID 97256616) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is methyl (2S,3S)-3-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pent-4-enoate.
| Compound Name | methyl (2S,3S)-3-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 97256616 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | methyl (2S,3S)-3-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pent-4-enoate |
| SMILES | C=C[C@H](C)[C@H](NC(=O)Cc1c(C)[nH]c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C18H22N2O3/c1-5-11(2)17(18(22)23-4)20-16(21)10-14-12(3)19-15-9-7-6-8-13(14)15/h5-9,11,17,19H,1,10H2,2-4H3,(H,20,21)/t11-,17-/m0/s1 |
| InChIKey | IVAWMVMXAVBVGC-GTNSWQLSSA-N |
| XLogP | 2.50 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|