C17H19ClN4 — CID 97257201
5-chloro-N-[(2R)-3-imidazol-1-yl-2-methylpropyl]-8-methylquinolin-2-amine (PubChem CID 97257201) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is 5-chloro-N-[(2R)-3-imidazol-1-yl-2-methylpropyl]-8-methylquinolin-2-amine.
| Compound Name | 5-chloro-N-[(2R)-3-imidazol-1-yl-2-methylpropyl]-8-methylquinolin-2-amine |
|---|---|
| PubChem CID | 97257201 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5-chloro-N-[(2R)-3-imidazol-1-yl-2-methylpropyl]-8-methylquinolin-2-amine |
| SMILES | Cc1ccc(Cl)c2ccc(NC[C@@H](C)Cn3ccnc3)nc12 |
| InChI | InChI=1S/C17H19ClN4/c1-12(10-22-8-7-19-11-22)9-20-16-6-4-14-15(18)5-3-13(2)17(14)21-16/h3-8,11-12H,9-10H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | VRHZMLQXQAESEN-GFCCVEGCSA-N |
| XLogP | 4.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |