C16H21N5O2 — CID 97257371
1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea (PubChem CID 97257371) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 97257371 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(1S)-1-(1H-1,2,4-triazol-5-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(OC2CCCC2)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C16H21N5O2/c1-11(15-17-10-18-21-15)19-16(22)20-12-6-8-14(9-7-12)23-13-4-2-3-5-13/h6-11,13H,2-5H2,1H3,(H,17,18,21)(H2,19,20,22)/t11-/m0/s1 |
| InChIKey | DLVWLPGSYMKMBT-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |