C16H16N6O2S — CID 97257659
N'-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-N-(3-phenyl-1,2-thiazol-5-yl)oxamide (PubChem CID 97257659) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is N'-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-N-(3-phenyl-1,2-thiazol-5-yl)oxamide.
| Compound Name | N'-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-N-(3-phenyl-1,2-thiazol-5-yl)oxamide |
|---|---|
| PubChem CID | 97257659 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N'-[(1R)-1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-N-(3-phenyl-1,2-thiazol-5-yl)oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)Nc1cc(-c2ccccc2)ns1)c1nncn1C |
| InChI | InChI=1S/C16H16N6O2S/c1-10(14-20-17-9-22(14)2)18-15(23)16(24)19-13-8-12(21-25-13)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,18,23)(H,19,24)/t10-/m1/s1 |
| InChIKey | CSWMQCIDSMQOMI-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|