C19H20ClN3O2S — CID 97257674
N'-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-N-[[(1R)-cyclohex-3-en-1-yl]methyl]oxamide (PubChem CID 97257674) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is N'-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-N-[[(1R)-cyclohex-3-en-1-yl]methyl]oxamide.
| Compound Name | N'-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-N-[[(1R)-cyclohex-3-en-1-yl]methyl]oxamide |
|---|---|
| PubChem CID | 97257674 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N'-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-N-[[(1R)-cyclohex-3-en-1-yl]methyl]oxamide |
| SMILES | O=C(NC[C@H]1CC=CCC1)C(=O)Nc1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C19H20ClN3O2S/c20-16-9-5-4-8-14(16)10-15-12-22-19(26-15)23-18(25)17(24)21-11-13-6-2-1-3-7-13/h1-2,4-5,8-9,12-13H,3,6-7,10-11H2,(H,21,24)(H,22,23,25)/t13-/m0/s1 |
| InChIKey | OVFUZBMDRHVXDN-ZDUSSCGKSA-N |
| XLogP | 3.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|