About N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide
N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 97258866) has the molecular formula C19H24N2O3
and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide |
| PubChem CID | 97258866 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NC[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C19H24N2O3/c22-18(10-14-11-20-17-7-3-2-6-16(14)17)21-12-15-13-23-19(24-15)8-4-1-5-9-19/h2-3,6-7,11,15,20H,1,4-5,8-10,12-13H2,(H,21,22)/t15-/m1/s1 |
| InChIKey | DLJJEWSHKFSZBK-OAHLLOKOSA-N |
| XLogP | 2.90 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide?
The IUPAC name of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide (CID 97258866) is N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide.
What is the SMILES notation for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide?
The canonical SMILES for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide is O=C(Cc1c[nH]c2ccccc12)NC[C@@H]1COC2(CCCCC2)O1.
What is the InChIKey of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide?
The InChIKey is DLJJEWSHKFSZBK-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H24N2O3/c22-18(10-14-11-20-17-7-3-2-6-16(14)17)21-12-15-13-23-19(24-15)8-4-1-5-9-19/h2-3,6-7,11,15,20H,1,4-5,8-10,12-13H2,(H,21,22)/t15-/m1/s1.
What are the key properties of N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide?
N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide has a molecular weight of 328.41 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-2-(1H-indol-3-yl)acetamide is sourced from PubChem (CID 97258866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).