C18H20F3N3O — CID 97259038
1-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 97259038) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 97259038 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[(2R)-1-[benzyl(methyl)amino]propan-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | C[C@H](CN(C)Cc1ccccc1)NC(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H20F3N3O/c1-12(10-24(2)11-13-6-4-3-5-7-13)22-18(25)23-17-9-15(20)14(19)8-16(17)21/h3-9,12H,10-11H2,1-2H3,(H2,22,23,25)/t12-/m1/s1 |
| InChIKey | SMUOVCWKMJTHJN-GFCCVEGCSA-N |
| XLogP | 3.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|