C22H31ClN4O2 — CID 97260350
trans-(1R,2R)-2-(6-chloro-1H-benzimidazol-2-yl)-N-[4-(diethylamino)-4-oxobutyl]cyclohexane-1-carboxamide (PubChem CID 97260350) has the molecular formula C22H31ClN4O2 and a molecular weight of 418.97 g/mol. Its IUPAC name is trans-(1R,2R)-2-(6-chloro-1H-benzimidazol-2-yl)-N-[4-(diethylamino)-4-oxobutyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-(6-chloro-1H-benzimidazol-2-yl)-N-[4-(diethylamino)-4-oxobutyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 97260350 |
| Molecular Formula | C22H31ClN4O2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | trans-(1R,2R)-2-(6-chloro-1H-benzimidazol-2-yl)-N-[4-(diethylamino)-4-oxobutyl]cyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)[C@@H]1CCCC[C@H]1c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H31ClN4O2/c1-3-27(4-2)20(28)10-7-13-24-22(29)17-9-6-5-8-16(17)21-25-18-12-11-15(23)14-19(18)26-21/h11-12,14,16-17H,3-10,13H2,1-2H3,(H,24,29)(H,25,26)/t16-,17-/m1/s1 |
| InChIKey | ZBTRSKHNCIBAKT-IAGOWNOFSA-N |
| XLogP | 4.25 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|