C21H21Cl2N5O2S — CID 97263176
(6R,7S)-N-(3,5-dichlorophenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 97263176) has the molecular formula C21H21Cl2N5O2S and a molecular weight of 478.41 g/mol. Its IUPAC name is (6R,7S)-N-(3,5-dichlorophenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6R,7S)-N-(3,5-dichlorophenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 97263176 |
| Molecular Formula | C21H21Cl2N5O2S |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | (6R,7S)-N-(3,5-dichlorophenyl)-6-(4-methoxyphenyl)-3-propyl-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCCc1nnc2n1N[C@H](c1ccc(OC)cc1)[C@@H](C(=O)Nc1cc(Cl)cc(Cl)c1)S2 |
| InChI | InChI=1S/C21H21Cl2N5O2S/c1-3-4-17-25-26-21-28(17)27-18(12-5-7-16(30-2)8-6-12)19(31-21)20(29)24-15-10-13(22)9-14(23)11-15/h5-11,18-19,27H,3-4H2,1-2H3,(H,24,29)/t18-,19+/m1/s1 |
| InChIKey | GKUCMYBIVHXXSC-MOPGFXCFSA-N |
| XLogP | 4.94 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |