C22H17F3O5S — CID 97264471
methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanoate (PubChem CID 97264471) has the molecular formula C22H17F3O5S and a molecular weight of 450.43 g/mol. Its IUPAC name is methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanoate.
| Compound Name | methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 97264471 |
| Molecular Formula | C22H17F3O5S |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | methyl (3S)-3-[3-hydroxy-4-oxo-6-(phenylsulfanylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanoate |
| SMILES | COC(=O)C[C@@H](c1cc(F)c(F)c(F)c1)c1oc(CSc2ccccc2)cc(=O)c1O |
| InChI | InChI=1S/C22H17F3O5S/c1-29-19(27)10-15(12-7-16(23)20(25)17(24)8-12)22-21(28)18(26)9-13(30-22)11-31-14-5-3-2-4-6-14/h2-9,15,28H,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | RLJOWZIKGRNVRV-HNNXBMFYSA-N |
| XLogP | 4.75 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|