C18H18N6O3 — CID 97265525
(2R)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-phenyl-2-(tetrazol-1-yl)ethanone (PubChem CID 97265525) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is (2R)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-phenyl-2-(tetrazol-1-yl)ethanone.
| Compound Name | (2R)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-phenyl-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 97265525 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (2R)-1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-phenyl-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)[C@@H](c2ccccc2)n2cnnn2)CC1 |
| InChI | InChI=1S/C18H18N6O3/c25-17(15-7-4-12-27-15)22-8-10-23(11-9-22)18(26)16(24-13-19-20-21-24)14-5-2-1-3-6-14/h1-7,12-13,16H,8-11H2/t16-/m1/s1 |
| InChIKey | JQXHMPKKNOAKON-MRXNPFEDSA-N |
| XLogP | 0.84 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |