C20H26N4S — CID 97268462
1-(6-methyl-2-phenylpyrimidin-4-yl)-N-[(3R)-thiolan-3-yl]piperidin-4-amine (PubChem CID 97268462) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-(6-methyl-2-phenylpyrimidin-4-yl)-N-[(3R)-thiolan-3-yl]piperidin-4-amine.
| Compound Name | 1-(6-methyl-2-phenylpyrimidin-4-yl)-N-[(3R)-thiolan-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 97268462 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-(6-methyl-2-phenylpyrimidin-4-yl)-N-[(3R)-thiolan-3-yl]piperidin-4-amine |
| SMILES | Cc1cc(N2CCC(N[C@@H]3CCSC3)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H26N4S/c1-15-13-19(23-20(21-15)16-5-3-2-4-6-16)24-10-7-17(8-11-24)22-18-9-12-25-14-18/h2-6,13,17-18,22H,7-12,14H2,1H3/t18-/m1/s1 |
| InChIKey | PRFPPMKLVAASRF-GOSISDBHSA-N |
| XLogP | 3.52 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |