C22H32N2O3 — CID 97268661
N-benzyl-N-methyl-3-[1-[(2R)-oxane-2-carbonyl]piperidin-4-yl]propanamide (PubChem CID 97268661) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[1-[(2R)-oxane-2-carbonyl]piperidin-4-yl]propanamide.
| Compound Name | N-benzyl-N-methyl-3-[1-[(2R)-oxane-2-carbonyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 97268661 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-benzyl-N-methyl-3-[1-[(2R)-oxane-2-carbonyl]piperidin-4-yl]propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCC1CCN(C(=O)[C@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-23(17-19-7-3-2-4-8-19)21(25)11-10-18-12-14-24(15-13-18)22(26)20-9-5-6-16-27-20/h2-4,7-8,18,20H,5-6,9-17H2,1H3/t20-/m1/s1 |
| InChIKey | IESIVOMMLUVRKT-HXUWFJFHSA-N |
| XLogP | 3.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |