C24H35N3O4 — CID 91602871
N-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 91602871) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91602871 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | N-methoxy-N-[1-[[1-(oxolane-2-carbonyl)piperidin-4-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | CON(C(=O)c1ccccc1)C1CCN(CC2CCN(C(=O)C3CCCO3)CC2)CC1 |
| InChI | InChI=1S/C24H35N3O4/c1-30-27(23(28)20-6-3-2-4-7-20)21-11-13-25(14-12-21)18-19-9-15-26(16-10-19)24(29)22-8-5-17-31-22/h2-4,6-7,19,21-22H,5,8-18H2,1H3 |
| InChIKey | ONUUHTQAKIRWDV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|