C14H16N4O2S — CID 97273486
(3S)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 97273486) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is (3S)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 97273486 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (3S)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(NCCSc1ncn[nH]1)[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C14H16N4O2S/c19-13(15-5-6-21-14-16-9-17-18-14)11-7-10-3-1-2-4-12(10)20-8-11/h1-4,9,11H,5-8H2,(H,15,19)(H,16,17,18)/t11-/m0/s1 |
| InChIKey | SOIMVPUBKSCRCR-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|