C16H20N4O2 — CID 97280110
(3R)-3-(hydroxymethyl)-N-(3-methylcinnolin-5-yl)piperidine-1-carboxamide (PubChem CID 97280110) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3R)-3-(hydroxymethyl)-N-(3-methylcinnolin-5-yl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(hydroxymethyl)-N-(3-methylcinnolin-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97280110 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3R)-3-(hydroxymethyl)-N-(3-methylcinnolin-5-yl)piperidine-1-carboxamide |
| SMILES | Cc1cc2c(NC(=O)N3CCC[C@@H](CO)C3)cccc2nn1 |
| InChI | InChI=1S/C16H20N4O2/c1-11-8-13-14(5-2-6-15(13)19-18-11)17-16(22)20-7-3-4-12(9-20)10-21/h2,5-6,8,12,21H,3-4,7,9-10H2,1H3,(H,17,22)/t12-/m1/s1 |
| InChIKey | HAPUTWLRMCKLJN-GFCCVEGCSA-N |
| XLogP | 2.17 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |