C18H22N6O — CID 97284208
1-(2,3-dimethylquinoxalin-6-yl)-3-[(2S)-1-imidazol-1-ylbutan-2-yl]urea (PubChem CID 97284208) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-(2,3-dimethylquinoxalin-6-yl)-3-[(2S)-1-imidazol-1-ylbutan-2-yl]urea.
| Compound Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-[(2S)-1-imidazol-1-ylbutan-2-yl]urea |
|---|---|
| PubChem CID | 97284208 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-[(2S)-1-imidazol-1-ylbutan-2-yl]urea |
| SMILES | CC[C@@H](Cn1ccnc1)NC(=O)Nc1ccc2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C18H22N6O/c1-4-14(10-24-8-7-19-11-24)22-18(25)23-15-5-6-16-17(9-15)21-13(3)12(2)20-16/h5-9,11,14H,4,10H2,1-3H3,(H2,22,23,25)/t14-/m0/s1 |
| InChIKey | CWGKLBWFDUGMCK-AWEZNQCLSA-N |
| XLogP | 3.04 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |